Biochemical Reagents
Filtered Search Results
4-tert-Butylcyclohexanecarboxylic acid, predominantly trans, 98+%
CAS: 5451-55-8 Molecular Formula: C11H20O2 Molecular Weight (g/mol): 184.279 MDL Number: MFCD00042622 InChI Key: QVQKEGYITJBHRQ-UHFFFAOYSA-N Synonym: trans-4-tert-butylcyclohexanecarboxylic acid,4-tert-butylcyclohexanecarboxylic acid,cis-4-tert-butylcyclohexanecarboxylic acid,trans-4-tert-butyl cyclohexanecarboxylic acid,4-tert-butyl cyclohexanecarboxylic acid,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl-, cis,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl,cis-4-tert-butylcyclohexane carboxylic acid,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl-, trans,qvqkegyitjbhrq-dtorhvgosa-n PubChem CID: 136759 IUPAC Name: 4-tert-butylcyclohexane-1-carboxylic acid SMILES: CC(C)(C)C1CCC(CC1)C(=O)O
| PubChem CID | 136759 |
|---|---|
| CAS | 5451-55-8 |
| Molecular Weight (g/mol) | 184.279 |
| MDL Number | MFCD00042622 |
| SMILES | CC(C)(C)C1CCC(CC1)C(=O)O |
| Synonym | trans-4-tert-butylcyclohexanecarboxylic acid,4-tert-butylcyclohexanecarboxylic acid,cis-4-tert-butylcyclohexanecarboxylic acid,trans-4-tert-butyl cyclohexanecarboxylic acid,4-tert-butyl cyclohexanecarboxylic acid,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl-, cis,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl,cis-4-tert-butylcyclohexane carboxylic acid,cyclohexanecarboxylic acid, 4-1,1-dimethylethyl-, trans,qvqkegyitjbhrq-dtorhvgosa-n |
| IUPAC Name | 4-tert-butylcyclohexane-1-carboxylic acid |
| InChI Key | QVQKEGYITJBHRQ-UHFFFAOYSA-N |
| Molecular Formula | C11H20O2 |
2-Fluoro-alpha-methyl-4-biphenylacetic acid, 99%
CAS: 5104-49-4 Molecular Formula: C15H13FO2 Molecular Weight (g/mol): 244.27 MDL Number: MFCD00079303 InChI Key: SYTBZMRGLBWNTM-UHFFFAOYNA-N Synonym: flurbiprofen,ansaid,froben,antadys,cebutid,flurofen,anside,flurbiprofene,flurbiprofeno,flurbiprofenum PubChem CID: 3394 ChEBI: CHEBI:5130 SMILES: CC(C(O)=O)C1=CC=C(C(F)=C1)C1=CC=CC=C1
| PubChem CID | 3394 |
|---|---|
| CAS | 5104-49-4 |
| Molecular Weight (g/mol) | 244.27 |
| ChEBI | CHEBI:5130 |
| MDL Number | MFCD00079303 |
| SMILES | CC(C(O)=O)C1=CC=C(C(F)=C1)C1=CC=CC=C1 |
| Synonym | flurbiprofen,ansaid,froben,antadys,cebutid,flurofen,anside,flurbiprofene,flurbiprofeno,flurbiprofenum |
| InChI Key | SYTBZMRGLBWNTM-UHFFFAOYNA-N |
| Molecular Formula | C15H13FO2 |
Norbornane-2-carboxylic acid, 98%, predominantly endo isomer
CAS: 824-62-4 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.18 MDL Number: MFCD00167749 InChI Key: JESWDXIHOJGWBP-UHFFFAOYNA-N Synonym: bicyclo 2.2.1 heptane-2-carboxylic acid,2-norbornanecarboxylic acid,norbornane-2-carboxylic acid,2-norbornanecarboxylic acid, endo,bicyclo 2.2.1 heptane-2-carboxylic acid, endo,exo-norbornane-2-carboxylic acid,bicyclo 2.2.1 heptane-3-carboxylic acid,2-norbornanecarboxlic acid PubChem CID: 79113 SMILES: OC(=O)C1CC2CCC1C2
| PubChem CID | 79113 |
|---|---|
| CAS | 824-62-4 |
| Molecular Weight (g/mol) | 140.18 |
| MDL Number | MFCD00167749 |
| SMILES | OC(=O)C1CC2CCC1C2 |
| Synonym | bicyclo 2.2.1 heptane-2-carboxylic acid,2-norbornanecarboxylic acid,norbornane-2-carboxylic acid,2-norbornanecarboxylic acid, endo,bicyclo 2.2.1 heptane-2-carboxylic acid, endo,exo-norbornane-2-carboxylic acid,bicyclo 2.2.1 heptane-3-carboxylic acid,2-norbornanecarboxlic acid |
| InChI Key | JESWDXIHOJGWBP-UHFFFAOYNA-N |
| Molecular Formula | C8H12O2 |
| Conjugate | Unconjugated |
|---|---|
| Form | Liquid |
| Molecular Weight (g/mol) | 46 kDa |
| Common Name | Factor Xa |
| Gene Symbol | F10 |
| Storage Requirements | -20°C, Avoid Freeze/Thaw Cycles |
| Concentration | 1.8 mg/mL |
| For Use With (Application) | Neutralization |
| Name | Human Factor Xa |
| Accession Number | P00742 |
| Regulatory Status | RUO |
| Purification Method | SDS-PAGE |
| Gene Alias | Activated factor Xa heavy chain; Coagulation factor X; F10; F10a; Factor X heavy chain; Factor X light chain; factor Xa; FX; FXA; prothrombinase; stuart factor; Stuart-Prower factor; Unknown (protein for IMAGE:8121240); unnamed protein product |
| Product Type | Protein |
| Gene ID (Entrez) | 2159 |
| Formulation | 50% water with 50% glycerol and no preservative |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Lyophilized |
| Molecular Weight (g/mol) | 54.2 kDa |
| Formulation | protein with 0.15 M NaCl, 0.2 M glycine and no preservative; pH 7.4 |
| Concentration | 0.1 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Apolipoprotein H |
Invitrogen™ Human Heparin Cofactor II (Serpin D1) Native Protein
Native Protein
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 65.6 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| Concentration | 5.9 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Heparin Cofactor II (Serpin D1) |
| Conjugate | Unconjugated |
|---|---|
| pH Range | 7.4 |
| Form | Liquid |
| Molecular Weight (g/mol) | 74 kDa |
| Common Name | Thrombomodulin (CD141) |
| Gene Symbol | THBD |
| Storage Requirements | -80°C, Avoid Freeze/Thaw Cycles |
| Concentration | 1.2 mg/mL |
| For Use With (Application) | Neutralization |
| Name | Rabbit Lung Thrombomodulin (BDCA-3) |
| Regulatory Status | RUO |
| Purification Method | SDS-PAGE |
| Gene Alias | AHUS6; AI385582; BDCA3; BDCA-3; CD141; CD141 antigen; DC141; fetomodulin; sCD141; snoRNA MBII-339; soluble CD141; THBD; THPH12; THRM; thrombomdulin; thrombomodulin; thrombomodulin precursor; TM |
| Product Type | Protein |
| Gene ID (Entrez) | 100008887 |
| Formulation | 0.05% PDOC, TBS with no preservative; pH 7.4 |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 75 kDa |
| Formulation | 0.05 M potassium phosphate with 0.15 M NaCl and no preservative; pH 7.4 |
| Concentration | 1.5 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Vitronectin |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 62 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Protein Z |
| Form | Lyophilized |
|---|---|
| Molecular Weight (g/mol) | 16.2 kd |
| Packaging | Plastic bottle |
| Conjugate | Unconjugated |
|---|---|
| Form | Liquid |
| Molecular Weight (g/mol) | 88 kDa |
| Common Name | glu-Plasminogen CHOII |
| Gene Symbol | PLG |
| Storage Requirements | -20°C, Avoid Freeze/Thaw Cycles |
| Concentration | 9 mg/mL |
| For Use With (Application) | Neutralization |
| Name | Human glu-Plasminogen CHOII |
| Accession Number | P00747 |
| Regulatory Status | RUO |
| Purification Method | SDS-PAGE |
| Gene Alias | Activation peptide; Angiostatin; plasmin; Plasmin heavy chain A; Plasmin heavy chain A, short form; Plasmin light chain B; Plasminogen; PLG |
| Product Type | Protein |
| Gene ID (Entrez) | 5340 |
| Formulation | 50% water with 50% glycerol and no preservative |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 55.4 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| For Use With (Application) | Control |
| Source | Bovine |
| Name | Bovine Factor IX |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 35.8 kDa |
| Formulation | 0.025 M HEPES with 0.15 M NaCl and no preservative; pH 7.4 |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human beta-Thromboglobulin |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 36.7 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| Concentration | 6.5 mg/mL |
| For Use With (Application) | Control |
| Source | Bovine |
| Name | Bovine alpha-Thrombin |